C19H20O4 — CID 134940853
5,12,13,14-tetramethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene (PubChem CID 134940853) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5,12,13,14-tetramethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene.
| Compound Name | 5,12,13,14-tetramethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene |
|---|---|
| PubChem CID | 134940853 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5,12,13,14-tetramethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene |
| SMILES | COc1ccc2c(c1)C=CCc1c-2cc(OC)c(OC)c1OC |
| InChI | InChI=1S/C19H20O4/c1-20-13-8-9-14-12(10-13)6-5-7-15-16(14)11-17(21-2)19(23-4)18(15)22-3/h5-6,8-11H,7H2,1-4H3 |
| InChIKey | TWUSVZKIPYZHPE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |