About 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole
2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole (PubChem CID 13011434) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole |
| PubChem CID | 13011434 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole |
| SMILES | COc1ccc(-c2cc3c(OC)ccc(OC)c3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C18H19NO4/c1-20-11-5-6-12(17(9-11)23-4)14-10-13-15(21-2)7-8-16(22-3)18(13)19-14/h5-10,19H,1-4H3 |
| InChIKey | VASIGVBDWFLQOO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole (CID 13011434) is 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole is COc1ccc(-c2cc3c(OC)ccc(OC)c3[nH]2)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole?
The InChIKey is VASIGVBDWFLQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-20-11-5-6-12(17(9-11)23-4)14-10-13-15(21-2)7-8-16(22-3)18(13)19-14/h5-10,19H,1-4H3.
What are the key properties of 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole?
2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole has a molecular weight of 313.35 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-4,7-dimethoxy-1H-indole is sourced from PubChem (CID 13011434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).