C21H21NO4 — CID 90670585
2-(2,3-dimethoxyphenyl)-6-(2,4-dimethoxyphenyl)pyridine (PubChem CID 90670585) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-6-(2,4-dimethoxyphenyl)pyridine.
| Compound Name | 2-(2,3-dimethoxyphenyl)-6-(2,4-dimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 90670585 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-6-(2,4-dimethoxyphenyl)pyridine |
| SMILES | COc1ccc(-c2cccc(-c3cccc(OC)c3OC)n2)c(OC)c1 |
| InChI | InChI=1S/C21H21NO4/c1-23-14-11-12-15(20(13-14)25-3)17-8-6-9-18(22-17)16-7-5-10-19(24-2)21(16)26-4/h5-13H,1-4H3 |
| InChIKey | RVTJOWVFCCAVCS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |