C15H16O3 — CID 57121160
1,2-dimethoxy-3-(3-methoxyphenyl)benzene (PubChem CID 57121160) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1,2-dimethoxy-3-(3-methoxyphenyl)benzene.
| Compound Name | 1,2-dimethoxy-3-(3-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 57121160 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1,2-dimethoxy-3-(3-methoxyphenyl)benzene |
| SMILES | COc1cccc(-c2cccc(OC)c2OC)c1 |
| InChI | InChI=1S/C15H16O3/c1-16-12-7-4-6-11(10-12)13-8-5-9-14(17-2)15(13)18-3/h4-10H,1-3H3 |
| InChIKey | JZRNNSOEZDWRRK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |