C16H12F6O4 — CID 91307892
1-[3,4-bis(trifluoromethoxy)phenyl]-2,3-dimethoxybenzene (PubChem CID 91307892) has the molecular formula C16H12F6O4 and a molecular weight of 382.26 g/mol. Its IUPAC name is 1-[3,4-bis(trifluoromethoxy)phenyl]-2,3-dimethoxybenzene.
| Compound Name | 1-[3,4-bis(trifluoromethoxy)phenyl]-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 91307892 |
| Molecular Formula | C16H12F6O4 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1-[3,4-bis(trifluoromethoxy)phenyl]-2,3-dimethoxybenzene |
| SMILES | COc1cccc(-c2ccc(OC(F)(F)F)c(OC(F)(F)F)c2)c1OC |
| InChI | InChI=1S/C16H12F6O4/c1-23-12-5-3-4-10(14(12)24-2)9-6-7-11(25-15(17,18)19)13(8-9)26-16(20,21)22/h3-8H,1-2H3 |
| InChIKey | CBWOBGPYOBDVJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |