C60H51BiO6S3 — CID 87490956
tris[[2,6-bis(3-methoxyphenyl)phenyl]sulfanyl]bismuthane (PubChem CID 87490956) has the molecular formula C60H51BiO6S3 and a molecular weight of 1173.24 g/mol. Its IUPAC name is tris[[2,6-bis(3-methoxyphenyl)phenyl]sulfanyl]bismuthane.
| Compound Name | tris[[2,6-bis(3-methoxyphenyl)phenyl]sulfanyl]bismuthane |
|---|---|
| PubChem CID | 87490956 |
| Molecular Formula | C60H51BiO6S3 |
| Molecular Weight | 1173.24 g/mol |
| Exact Mass | 1172.27 |
| IUPAC Name | tris[[2,6-bis(3-methoxyphenyl)phenyl]sulfanyl]bismuthane |
| SMILES | COc1cccc(-c2cccc(-c3cccc(OC)c3)c2S[Bi](Sc2c(-c3cccc(OC)c3)cccc2-c2cccc(OC)c2)Sc2c(-c3cccc(OC)c3)cccc2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/3C20H18O2S.Bi/c3*1-21-16-8-3-6-14(12-16)18-10-5-11-19(20(18)23)15-7-4-9-17(13-15)22-2;/h3*3-13,23H,1-2H3;/q;;;+3/p-3 |
| InChIKey | LJZRKUADUVPBFG-UHFFFAOYSA-K |
| XLogP | 16.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.24 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |