C26H28O5 — CID 102106088
5,6,12,13,19-pentamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(17),3,5,7,10,12,14,18,20-nonaene (PubChem CID 102106088) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 5,6,12,13,19-pentamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(17),3,5,7,10,12,14,18,20-nonaene.
| Compound Name | 5,6,12,13,19-pentamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(17),3,5,7,10,12,14,18,20-nonaene |
|---|---|
| PubChem CID | 102106088 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 5,6,12,13,19-pentamethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(17),3,5,7,10,12,14,18,20-nonaene |
| SMILES | COc1ccc2c(c1)Cc1cc(OC)c(OC)cc1Cc1cc(OC)c(OC)cc1C2 |
| InChI | InChI=1S/C26H28O5/c1-27-22-7-6-16-8-18-12-23(28-2)25(30-4)14-20(18)10-21-15-26(31-5)24(29-3)13-19(21)9-17(16)11-22/h6-7,11-15H,8-10H2,1-5H3 |
| InChIKey | KMJLRGYPDPMHLH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |