C27H30O5 — CID 71028115
9-(3,5-dimethoxy-2-methylphenyl)-5,7,14-trimethoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 71028115) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is 9-(3,5-dimethoxy-2-methylphenyl)-5,7,14-trimethoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 9-(3,5-dimethoxy-2-methylphenyl)-5,7,14-trimethoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 71028115 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 9-(3,5-dimethoxy-2-methylphenyl)-5,7,14-trimethoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | COc1ccc2c(c1)Cc1cc(OC)cc(OC)c1C(c1cc(OC)cc(OC)c1C)C2 |
| InChI | InChI=1S/C27H30O5/c1-16-23(13-22(30-4)14-25(16)31-5)24-12-17-7-8-20(28-2)10-18(17)9-19-11-21(29-3)15-26(32-6)27(19)24/h7-8,10-11,13-15,24H,9,12H2,1-6H3 |
| InChIKey | LRPMFLBUIYRIPN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |