C19H18O — CID 22970361
5-methoxy-12-methylidenetetracyclo[8.6.1.03,8.013,17]heptadeca-1(17),3(8),4,6,13,15-hexaene (PubChem CID 22970361) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-methoxy-12-methylidenetetracyclo[8.6.1.03,8.013,17]heptadeca-1(17),3(8),4,6,13,15-hexaene.
| Compound Name | 5-methoxy-12-methylidenetetracyclo[8.6.1.03,8.013,17]heptadeca-1(17),3(8),4,6,13,15-hexaene |
|---|---|
| PubChem CID | 22970361 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-methoxy-12-methylidenetetracyclo[8.6.1.03,8.013,17]heptadeca-1(17),3(8),4,6,13,15-hexaene |
| SMILES | C=C1CC2Cc3ccc(OC)cc3Cc3cccc1c32 |
| InChI | InChI=1S/C19H18O/c1-12-8-16-9-13-6-7-17(20-2)11-15(13)10-14-4-3-5-18(12)19(14)16/h3-7,11,16H,1,8-10H2,2H3 |
| InChIKey | OCSQGKRICSLLQV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |