C35H38O9S — CID 71028144
(10R)-10-(3,4-dimethoxyphenyl)-4,6,12,14-tetramethoxy-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 71028144) has the molecular formula C35H38O9S and a molecular weight of 634.75 g/mol. Its IUPAC name is (10R)-10-(3,4-dimethoxyphenyl)-4,6,12,14-tetramethoxy-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | (10R)-10-(3,4-dimethoxyphenyl)-4,6,12,14-tetramethoxy-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 71028144 |
| Molecular Formula | C35H38O9S |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | (10R)-10-(3,4-dimethoxyphenyl)-4,6,12,14-tetramethoxy-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | COc1ccc(CS(=O)(=O)C2c3cc(OC)cc(OC)c3[C@@H](c3ccc(OC)c(OC)c3)Cc3cc(OC)cc(OC)c32)cc1 |
| InChI | InChI=1S/C35H38O9S/c1-38-24-11-8-21(9-12-24)20-45(36,37)35-28-17-26(40-3)19-32(44-7)34(28)27(22-10-13-29(41-4)30(16-22)42-5)15-23-14-25(39-2)18-31(43-6)33(23)35/h8-14,16-19,27,35H,15,20H2,1-7H3/t27-,35?/m1/s1 |
| InChIKey | QWSSPHZKGFOHOF-SDTLAYBJSA-N |
| XLogP | 6.14 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |