C34H34O8S — CID 71028015
4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 71028015) has the molecular formula C34H34O8S and a molecular weight of 602.70 g/mol. Its IUPAC name is 4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 71028015 |
| Molecular Formula | C34H34O8S |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methylsulfonyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | COc1ccc(CS(=O)(=O)C2c3cc(OC)cc(OC)c3C(c3ccc(OC)cc3)=Cc3cc(OC)cc(OC)c32)cc1 |
| InChI | InChI=1S/C34H34O8S/c1-37-24-11-7-21(8-12-24)20-43(35,36)34-29-17-27(40-4)19-31(42-6)33(29)28(22-9-13-25(38-2)14-10-22)16-23-15-26(39-3)18-30(41-5)32(23)34/h7-19,34H,20H2,1-6H3 |
| InChIKey | BXNFGNXTNACSRV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|