C13H21NO — CID 145416037
ethane;6-methoxy-8-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 145416037) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;6-methoxy-8-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | ethane;6-methoxy-8-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 145416037 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethane;6-methoxy-8-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC.COc1cc(C)c2c(c1)CCNC2 |
| InChI | InChI=1S/C11H15NO.C2H6/c1-8-5-10(13-2)6-9-3-4-12-7-11(8)9;1-2/h5-6,12H,3-4,7H2,1-2H3;1-2H3 |
| InChIKey | YJCIBKHSLMNILH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |