C17H18OS2 — CID 11289650
18-methoxy-3,11-dithiatricyclo[11.2.2.15,9]octadeca-1(16),5(18),6,8,13(17),14-hexaene (PubChem CID 11289650) has the molecular formula C17H18OS2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 18-methoxy-3,11-dithiatricyclo[11.2.2.15,9]octadeca-1(16),5(18),6,8,13(17),14-hexaene.
| Compound Name | 18-methoxy-3,11-dithiatricyclo[11.2.2.15,9]octadeca-1(16),5(18),6,8,13(17),14-hexaene |
|---|---|
| PubChem CID | 11289650 |
| Molecular Formula | C17H18OS2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 18-methoxy-3,11-dithiatricyclo[11.2.2.15,9]octadeca-1(16),5(18),6,8,13(17),14-hexaene |
| SMILES | COc1c2cccc1CSCc1ccc(cc1)CSC2 |
| InChI | InChI=1S/C17H18OS2/c1-18-17-15-3-2-4-16(17)12-20-10-14-7-5-13(6-8-14)9-19-11-15/h2-8H,9-12H2,1H3 |
| InChIKey | LMWXTUZJGXOHQO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |