C35H38OS2 — CID 11570146
9,16-ditert-butyl-28-methoxy-3,22-dithiahexacyclo[22.3.1.05,14.07,12.011,20.013,18]octacosa-1(28),5,7,9,11,13,15,17,19,24,26-undecaene (PubChem CID 11570146) has the molecular formula C35H38OS2 and a molecular weight of 538.82 g/mol. Its IUPAC name is 9,16-ditert-butyl-28-methoxy-3,22-dithiahexacyclo[22.3.1.05,14.07,12.011,20.013,18]octacosa-1(28),5,7,9,11,13,15,17,19,24,26-undecaene.
| Compound Name | 9,16-ditert-butyl-28-methoxy-3,22-dithiahexacyclo[22.3.1.05,14.07,12.011,20.013,18]octacosa-1(28),5,7,9,11,13,15,17,19,24,26-undecaene |
|---|---|
| PubChem CID | 11570146 |
| Molecular Formula | C35H38OS2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 9,16-ditert-butyl-28-methoxy-3,22-dithiahexacyclo[22.3.1.05,14.07,12.011,20.013,18]octacosa-1(28),5,7,9,11,13,15,17,19,24,26-undecaene |
| SMILES | COc1c2cccc1CSCc1cc3cc(C(C)(C)C)cc4c(cc5cc(C(C)(C)C)cc1c5c34)CSC2 |
| InChI | InChI=1S/C35H38OS2/c1-34(2,3)27-13-23-11-26-20-38-18-22-10-8-9-21(33(22)36-7)17-37-19-25-12-24-14-28(35(4,5)6)16-30(26)32(24)31(23)29(25)15-27/h8-16H,17-20H2,1-7H3 |
| InChIKey | WWALTRDCGHLEQN-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|