C34H35NO2S2 — CID 101213793
9,16-ditert-butyl-28-nitro-3,22-dithiahexacyclo[22.3.1.05,14.08,13.011,20.012,17]octacosa-1(28),5(14),6,8(13),9,11(20),12(17),15,18,24,26-undecaene (PubChem CID 101213793) has the molecular formula C34H35NO2S2 and a molecular weight of 553.79 g/mol. Its IUPAC name is 9,16-ditert-butyl-28-nitro-3,22-dithiahexacyclo[22.3.1.05,14.08,13.011,20.012,17]octacosa-1(28),5(14),6,8(13),9,11(20),12(17),15,18,24,26-undecaene.
| Compound Name | 9,16-ditert-butyl-28-nitro-3,22-dithiahexacyclo[22.3.1.05,14.08,13.011,20.012,17]octacosa-1(28),5(14),6,8(13),9,11(20),12(17),15,18,24,26-undecaene |
|---|---|
| PubChem CID | 101213793 |
| Molecular Formula | C34H35NO2S2 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 9,16-ditert-butyl-28-nitro-3,22-dithiahexacyclo[22.3.1.05,14.08,13.011,20.012,17]octacosa-1(28),5(14),6,8(13),9,11(20),12(17),15,18,24,26-undecaene |
| SMILES | CC(C)(C)c1cc2c3ccc4c(C(C)(C)C)cc5c(ccc1c5c24)CSCc1cccc(c1[N+](=O)[O-])CSC3 |
| InChI | InChI=1S/C34H35NO2S2/c1-33(2,3)28-14-26-20-11-13-25-29(34(4,5)6)15-27-21(10-12-24(28)30(27)31(25)26)17-39-19-23-9-7-8-22(18-38-16-20)32(23)35(36)37/h7-15H,16-19H2,1-6H3 |
| InChIKey | VPRZOGFAEUTNTJ-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|