C33H43NO2S4 — CID 101271386
5,23-ditert-butyl-25,27-dimethoxy-8,10,18,20-tetrathiatetracyclo[19.3.1.13,7.112,16]heptacosa-1(25),3(27),4,6,12(26),13,15,21,23-nonaen-26-amine (PubChem CID 101271386) has the molecular formula C33H43NO2S4 and a molecular weight of 613.98 g/mol. Its IUPAC name is 5,23-ditert-butyl-25,27-dimethoxy-8,10,18,20-tetrathiatetracyclo[19.3.1.13,7.112,16]heptacosa-1(25),3(27),4,6,12(26),13,15,21,23-nonaen-26-amine.
| Compound Name | 5,23-ditert-butyl-25,27-dimethoxy-8,10,18,20-tetrathiatetracyclo[19.3.1.13,7.112,16]heptacosa-1(25),3(27),4,6,12(26),13,15,21,23-nonaen-26-amine |
|---|---|
| PubChem CID | 101271386 |
| Molecular Formula | C33H43NO2S4 |
| Molecular Weight | 613.98 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 5,23-ditert-butyl-25,27-dimethoxy-8,10,18,20-tetrathiatetracyclo[19.3.1.13,7.112,16]heptacosa-1(25),3(27),4,6,12(26),13,15,21,23-nonaen-26-amine |
| SMILES | COc1c2cc(C(C)(C)C)cc1SCSCc1cccc(c1N)CSCSc1cc(C(C)(C)C)cc(c1OC)C2 |
| InChI | InChI=1S/C33H43NO2S4/c1-32(2,3)25-13-23-12-24-14-26(33(4,5)6)16-28(31(24)36-8)40-20-38-18-22-11-9-10-21(29(22)34)17-37-19-39-27(15-25)30(23)35-7/h9-11,13-16H,12,17-20,34H2,1-8H3 |
| InChIKey | JYAWOUOUQBCKSC-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.98 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|