C16H7F12NS2 — CID 163299178
1-[[3,5-bis(trifluoromethyl)phenyl]sulfanylamino]sulfanyl-3,5-bis(trifluoromethyl)benzene (PubChem CID 163299178) has the molecular formula C16H7F12NS2 and a molecular weight of 505.35 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]sulfanylamino]sulfanyl-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]sulfanylamino]sulfanyl-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 163299178 |
| Molecular Formula | C16H7F12NS2 |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 504.98 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]sulfanylamino]sulfanyl-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(SNSc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H7F12NS2/c17-13(18,19)7-1-8(14(20,21)22)4-11(3-7)30-29-31-12-5-9(15(23,24)25)2-10(6-12)16(26,27)28/h1-6,29H |
| InChIKey | VDFKHUARVHOXHT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|