C30H13F18NS3 — CID 139901897
2,4,6-tris[[3,5-bis(trifluoromethyl)phenyl]sulfanyl]aniline (PubChem CID 139901897) has the molecular formula C30H13F18NS3 and a molecular weight of 825.61 g/mol. Its IUPAC name is 2,4,6-tris[[3,5-bis(trifluoromethyl)phenyl]sulfanyl]aniline.
| Compound Name | 2,4,6-tris[[3,5-bis(trifluoromethyl)phenyl]sulfanyl]aniline |
|---|---|
| PubChem CID | 139901897 |
| Molecular Formula | C30H13F18NS3 |
| Molecular Weight | 825.61 g/mol |
| Exact Mass | 824.99 |
| IUPAC Name | 2,4,6-tris[[3,5-bis(trifluoromethyl)phenyl]sulfanyl]aniline |
| SMILES | Nc1c(Sc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(Sc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Sc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H13F18NS3/c31-25(32,33)12-1-13(26(34,35)36)5-18(4-12)50-21-10-22(51-19-6-14(27(37,38)39)2-15(7-19)28(40,41)42)24(49)23(11-21)52-20-8-16(29(43,44)45)3-17(9-20)30(46,47)48/h1-11H,49H2 |
| InChIKey | DDIBRANWHGUVQW-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.61 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|