C13H16F6N2S — CID 142230191
N'-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-2-methylbutane-1,4-diamine (PubChem CID 142230191) has the molecular formula C13H16F6N2S and a molecular weight of 346.34 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-2-methylbutane-1,4-diamine.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 142230191 |
| Molecular Formula | C13H16F6N2S |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-2-methylbutane-1,4-diamine |
| SMILES | CC(CN)CCNSc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F6N2S/c1-8(7-20)2-3-21-22-11-5-9(12(14,15)16)4-10(6-11)13(17,18)19/h4-6,8,21H,2-3,7,20H2,1H3 |
| InChIKey | BOJLPIUYLVAXSF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|