About N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane
N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane (PubChem CID 142229110) has the molecular formula C10H11F6NS
and a molecular weight of 291.26 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane.
Molecular Properties
| Compound Name | N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane |
| PubChem CID | 142229110 |
| Molecular Formula | C10H11F6NS |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane |
| SMILES | CF.CNSc1cc(C(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F5NS.CH3F/c1-15-16-7-3-5(8(10)11)2-6(4-7)9(12,13)14;1-2/h2-4,8,15H,1H3;1H3 |
| InChIKey | KEMRGJNOWNLQJY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane?
The IUPAC name of N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane (CID 142229110) is N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane.
What is the SMILES notation for N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane?
The canonical SMILES for N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane is CF.CNSc1cc(C(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane?
The InChIKey is KEMRGJNOWNLQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F5NS.CH3F/c1-15-16-7-3-5(8(10)11)2-6(4-7)9(12,13)14;1-2/h2-4,8,15H,1H3;1H3.
What are the key properties of N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane?
N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane has a molecular weight of 291.26 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]sulfanylmethanamine;fluoromethane is sourced from PubChem (CID 142229110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).