C19H19ClO — CID 68584270
6-chloro-4-phenylmethoxy-5-prop-2-enyl-2,3-dihydro-1H-indene (PubChem CID 68584270) has the molecular formula C19H19ClO and a molecular weight of 298.81 g/mol. Its IUPAC name is 6-chloro-4-phenylmethoxy-5-prop-2-enyl-2,3-dihydro-1H-indene.
| Compound Name | 6-chloro-4-phenylmethoxy-5-prop-2-enyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 68584270 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-chloro-4-phenylmethoxy-5-prop-2-enyl-2,3-dihydro-1H-indene |
| SMILES | C=CCc1c(Cl)cc2c(c1OCc1ccccc1)CCC2 |
| InChI | InChI=1S/C19H19ClO/c1-2-7-17-18(20)12-15-10-6-11-16(15)19(17)21-13-14-8-4-3-5-9-14/h2-5,8-9,12H,1,6-7,10-11,13H2 |
| InChIKey | DTYYEYWAHJLMEL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|