C26H22Cl4O2 — CID 59551589
1,5-dichloro-2-[[4-[(2,4-dichloro-6-prop-2-enylphenoxy)methyl]phenyl]methoxy]-3-prop-2-enylbenzene (PubChem CID 59551589) has the molecular formula C26H22Cl4O2 and a molecular weight of 508.27 g/mol. Its IUPAC name is 1,5-dichloro-2-[[4-[(2,4-dichloro-6-prop-2-enylphenoxy)methyl]phenyl]methoxy]-3-prop-2-enylbenzene.
| Compound Name | 1,5-dichloro-2-[[4-[(2,4-dichloro-6-prop-2-enylphenoxy)methyl]phenyl]methoxy]-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 59551589 |
| Molecular Formula | C26H22Cl4O2 |
| Molecular Weight | 508.27 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | 1,5-dichloro-2-[[4-[(2,4-dichloro-6-prop-2-enylphenoxy)methyl]phenyl]methoxy]-3-prop-2-enylbenzene |
| SMILES | C=CCc1cc(Cl)cc(Cl)c1OCc1ccc(COc2c(Cl)cc(Cl)cc2CC=C)cc1 |
| InChI | InChI=1S/C26H22Cl4O2/c1-3-5-19-11-21(27)13-23(29)25(19)31-15-17-7-9-18(10-8-17)16-32-26-20(6-4-2)12-22(28)14-24(26)30/h3-4,7-14H,1-2,5-6,15-16H2 |
| InChIKey | UENFJLQRTTVROW-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.27 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|