C21H25ClO — CID 50888459
1-tert-butyl-2-[(4-chlorophenyl)methoxy]-5-methyl-3-prop-2-enylbenzene (PubChem CID 50888459) has the molecular formula C21H25ClO and a molecular weight of 328.88 g/mol. Its IUPAC name is 1-tert-butyl-2-[(4-chlorophenyl)methoxy]-5-methyl-3-prop-2-enylbenzene.
| Compound Name | 1-tert-butyl-2-[(4-chlorophenyl)methoxy]-5-methyl-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 50888459 |
| Molecular Formula | C21H25ClO |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-tert-butyl-2-[(4-chlorophenyl)methoxy]-5-methyl-3-prop-2-enylbenzene |
| SMILES | C=CCc1cc(C)cc(C(C)(C)C)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClO/c1-6-7-17-12-15(2)13-19(21(3,4)5)20(17)23-14-16-8-10-18(22)11-9-16/h6,8-13H,1,7,14H2,2-5H3 |
| InChIKey | ISOAFJUCJTYZMY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|