C21H21ClO3 — CID 141145497
ethyl 3-[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-enoate (PubChem CID 141145497) has the molecular formula C21H21ClO3 and a molecular weight of 356.85 g/mol. Its IUPAC name is ethyl 3-[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 141145497 |
| Molecular Formula | C21H21ClO3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | ethyl 3-[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]prop-2-enoate |
| SMILES | C=CCc1cc(C=CC(=O)OCC)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClO3/c1-3-5-18-14-16(9-13-21(23)24-4-2)8-12-20(18)25-15-17-6-10-19(22)11-7-17/h3,6-14H,1,4-5,15H2,2H3 |
| InChIKey | FLNGYGRIKKRXKV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|