C14H16N2O — CID 140998419
1-methyl-2,3,4,9-tetrahydro-1H-carbazole-4-carboxamide (PubChem CID 140998419) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-methyl-2,3,4,9-tetrahydro-1H-carbazole-4-carboxamide.
| Compound Name | 1-methyl-2,3,4,9-tetrahydro-1H-carbazole-4-carboxamide |
|---|---|
| PubChem CID | 140998419 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-methyl-2,3,4,9-tetrahydro-1H-carbazole-4-carboxamide |
| SMILES | CC1CCC(C(N)=O)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C14H16N2O/c1-8-6-7-10(14(15)17)12-9-4-2-3-5-11(9)16-13(8)12/h2-5,8,10,16H,6-7H2,1H3,(H2,15,17) |
| InChIKey | OPBURONBLDZHGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |