C13H15N3O — CID 66641029
1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide (PubChem CID 66641029) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide.
| Compound Name | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 66641029 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide |
| SMILES | NC(=O)C1CNCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C13H15N3O/c14-13(17)10-7-15-6-5-9-8-3-1-2-4-11(8)16-12(9)10/h1-4,10,15-16H,5-7H2,(H2,14,17) |
| InChIKey | CPIPLAWINNDLAV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |