C14H15N3O — CID 24852329
(2Z)-2-(2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)propanamide (PubChem CID 24852329) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is (2Z)-2-(2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)propanamide.
| Compound Name | (2Z)-2-(2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)propanamide |
|---|---|
| PubChem CID | 24852329 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (2Z)-2-(2,3,4,9-tetrahydropyrido[3,4-b]indol-1-ylidene)propanamide |
| SMILES | C/C(C(N)=O)=C1/NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C14H15N3O/c1-8(14(15)18)12-13-10(6-7-16-12)9-4-2-3-5-11(9)17-13/h2-5,16-17H,6-7H2,1H3,(H2,15,18)/b12-8- |
| InChIKey | ICCMFBSRMVPFKO-WQLSENKSSA-N |
| XLogP | 1.53 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|