C13H14N2O2 — CID 12708178
1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indole-1-carboxamide (PubChem CID 12708178) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indole-1-carboxamide.
| Compound Name | 1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 12708178 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indole-1-carboxamide |
| SMILES | CC1(C(N)=O)OCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C13H14N2O2/c1-13(12(14)16)11-9(6-7-17-13)8-4-2-3-5-10(8)15-11/h2-5,15H,6-7H2,1H3,(H2,14,16) |
| InChIKey | PWRWHHGNJIBUPD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |