C15H19NO2 — CID 59639732
2-(1-ethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol (PubChem CID 59639732) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-(1-ethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol.
| Compound Name | 2-(1-ethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol |
|---|---|
| PubChem CID | 59639732 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-(1-ethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol |
| SMILES | CCC1(CCO)OCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C15H19NO2/c1-2-15(8-9-17)14-12(7-10-18-15)11-5-3-4-6-13(11)16-14/h3-6,16-17H,2,7-10H2,1H3 |
| InChIKey | ZMUOMKZIKOZXEJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |