C18H24N2O5 — CID 3044833
N,N-dimethyl-2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanamine;oxalic acid (PubChem CID 3044833) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanamine;oxalic acid.
| Compound Name | N,N-dimethyl-2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 3044833 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N,N-dimethyl-2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanamine;oxalic acid |
| SMILES | CN(C)CCC1(C)OCCc2c1[nH]c1ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H22N2O.C2H2O4/c1-16(9-10-18(2)3)15-13(8-11-19-16)12-6-4-5-7-14(12)17-15;3-1(4)2(5)6/h4-7,17H,8-11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | OVTMPEOMIAZTTB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|