C28H40N2O8 — CID 25062479
1'-butyl-N,N-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 25062479) has the molecular formula C28H40N2O8 and a molecular weight of 532.63 g/mol. Its IUPAC name is 1'-butyl-N,N-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1'-butyl-N,N-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 25062479 |
| Molecular Formula | C28H40N2O8 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 1'-butyl-N,N-dimethylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCC1(N(C)C)CCC2(CC1)OCCc1c2[nH]c2ccccc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H32N2O.C6H8O7/c1-4-5-11-21(24(2)3)12-14-22(15-13-21)20-18(10-16-25-22)17-8-6-7-9-19(17)23-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h6-9,23H,4-5,10-16H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | MBNZAOBWHLVTGG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |