C31H38N2O8 — CID 66986523
2-hydroxypropane-1,2,3-tricarboxylic acid;N,N,3-trimethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine (PubChem CID 66986523) has the molecular formula C31H38N2O8 and a molecular weight of 566.65 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;N,N,3-trimethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N,N,3-trimethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
|---|---|
| PubChem CID | 66986523 |
| Molecular Formula | C31H38N2O8 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N,N,3-trimethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
| SMILES | CC1Cc2c([nH]c3ccccc23)C2(CCC(c3ccccc3)(N(C)C)CC2)O1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H30N2O.C6H8O7/c1-18-17-21-20-11-7-8-12-22(20)26-23(21)25(28-18)15-13-24(14-16-25,27(2)3)19-9-5-4-6-10-19;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-12,18,26H,13-17H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | XDOLBYXRBBPPEX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |