C39H42FN3O8 — CID 66710142
(E)-1-[1'-(dimethylamino)-1'-(3-fluorophenyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,4'-cyclohexane]-2-yl]-3-phenylprop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 66710142) has the molecular formula C39H42FN3O8 and a molecular weight of 699.78 g/mol. Its IUPAC name is (E)-1-[1'-(dimethylamino)-1'-(3-fluorophenyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,4'-cyclohexane]-2-yl]-3-phenylprop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (E)-1-[1'-(dimethylamino)-1'-(3-fluorophenyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,4'-cyclohexane]-2-yl]-3-phenylprop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 66710142 |
| Molecular Formula | C39H42FN3O8 |
| Molecular Weight | 699.78 g/mol |
| Exact Mass | 699.30 |
| IUPAC Name | (E)-1-[1'-(dimethylamino)-1'-(3-fluorophenyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,4'-cyclohexane]-2-yl]-3-phenylprop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C1(c2cccc(F)c2)CCC2(CC1)c1[nH]c3ccccc3c1CCN2C(=O)/C=C/c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C33H34FN3O.C6H8O7/c1-36(2)32(25-11-8-12-26(34)23-25)18-20-33(21-19-32)31-28(27-13-6-7-14-29(27)35-31)17-22-37(33)30(38)16-15-24-9-4-3-5-10-24;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-16,23,35H,17-22H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b16-15+; |
| InChIKey | OWDBMDGGYMYUJV-GEEYTBSJSA-N |
| XLogP | 5.38 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.78 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|