C28H33FN2O8S — CID 11169142
6-fluoro-N,N-dimethyl-1'-thiophen-2-ylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 11169142) has the molecular formula C28H33FN2O8S and a molecular weight of 576.64 g/mol. Its IUPAC name is 6-fluoro-N,N-dimethyl-1'-thiophen-2-ylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 6-fluoro-N,N-dimethyl-1'-thiophen-2-ylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 11169142 |
| Molecular Formula | C28H33FN2O8S |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 6-fluoro-N,N-dimethyl-1'-thiophen-2-ylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C1(c2cccs2)CCC2(CC1)OCCc1c2[nH]c2ccc(F)cc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H25FN2OS.C6H8O7/c1-25(2)21(19-4-3-13-27-19)8-10-22(11-9-21)20-16(7-12-26-22)17-14-15(23)5-6-18(17)24-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-6,13-14,24H,7-12H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | QFCMXEGRWBYPBA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |