C24H31NO3 — CID 10691264
[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate (PubChem CID 10691264) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate.
| Compound Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
|---|---|
| PubChem CID | 10691264 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
| SMILES | C[C@@H]1[C@@H](OC(=O)CC2(C)OCCc3c2[nH]c2ccccc32)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H31NO3/c1-14-18-11-15(23(18,2)3)12-20(14)28-21(26)13-24(4)22-17(9-10-27-24)16-7-5-6-8-19(16)25-22/h5-8,14-15,18,20,25H,9-13H2,1-4H3/t14-,15+,18-,20-,24?/m0/s1 |
| InChIKey | UHRYCYGXLVKQRX-AVORHFBASA-N |
| XLogP | 4.96 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |