C14H14N2O3 — CID 14218278
methyl 4-oxo-2,3,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 14218278) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is methyl 4-oxo-2,3,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | methyl 4-oxo-2,3,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 14218278 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | methyl 4-oxo-2,3,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | COC(=O)C1C(=O)NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C14H14N2O3/c1-19-14(18)11-12-9(6-7-15-13(11)17)8-4-2-3-5-10(8)16-12/h2-5,11,16H,6-7H2,1H3,(H,15,17) |
| InChIKey | BYXXNGQXRPCUBR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|