C20H21N3O — CID 151401798
N-benzyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide (PubChem CID 151401798) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-benzyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide.
| Compound Name | N-benzyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 151401798 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-benzyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CNCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C20H21N3O/c24-20(22-12-14-6-2-1-3-7-14)17-13-21-11-10-16-15-8-4-5-9-18(15)23-19(16)17/h1-9,17,21,23H,10-13H2,(H,22,24) |
| InChIKey | OWQKOAZJSFLJNG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |