C22H25N3O3 — CID 140998432
1-[(3,5-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole-4-carbohydrazide (PubChem CID 140998432) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole-4-carbohydrazide.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole-4-carbohydrazide |
|---|---|
| PubChem CID | 140998432 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole-4-carbohydrazide |
| SMILES | COc1cc(CC2CCC(C(=O)NN)c3c2[nH]c2ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-15-10-13(11-16(12-15)28-2)9-14-7-8-18(22(26)25-23)20-17-5-3-4-6-19(17)24-21(14)20/h3-6,10-12,14,18,24H,7-9,23H2,1-2H3,(H,25,26) |
| InChIKey | PJKLOIOMWMTOJW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|