C25H32N2O3 — CID 11025930
3-[(1R,3S)-1-(3,5-dimethoxyphenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]pentan-3-ol (PubChem CID 11025930) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-[(1R,3S)-1-(3,5-dimethoxyphenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]pentan-3-ol.
| Compound Name | 3-[(1R,3S)-1-(3,5-dimethoxyphenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]pentan-3-ol |
|---|---|
| PubChem CID | 11025930 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 3-[(1R,3S)-1-(3,5-dimethoxyphenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]pentan-3-ol |
| SMILES | CCC(O)(CC)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cc(OC)cc(OC)c2)N1C |
| InChI | InChI=1S/C25H32N2O3/c1-6-25(28,7-2)22-15-20-19-10-8-9-11-21(19)26-23(20)24(27(22)3)16-12-17(29-4)14-18(13-16)30-5/h8-14,22,24,26,28H,6-7,15H2,1-5H3/t22-,24+/m0/s1 |
| InChIKey | FCSXJDZAZGKUDC-LADGPHEKSA-N |
| XLogP | 4.68 |
| TPSA | 57.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|