C22H26N4O — CID 125169655
[6-(dimethylamino)-3-pyridinyl]-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 125169655) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is [6-(dimethylamino)-3-pyridinyl]-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | [6-(dimethylamino)-3-pyridinyl]-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 125169655 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [6-(dimethylamino)-3-pyridinyl]-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | CC(C)[C@H]1c2[nH]c3ccccc3c2CCN1C(=O)c1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C22H26N4O/c1-14(2)21-20-17(16-7-5-6-8-18(16)24-20)11-12-26(21)22(27)15-9-10-19(23-13-15)25(3)4/h5-10,13-14,21,24H,11-12H2,1-4H3/t21-/m0/s1 |
| InChIKey | YSRXDSZIOBGAEO-NRFANRHFSA-N |
| XLogP | 4.02 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|