C20H22N4O3 — CID 125174710
1-methyl-5-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyrimidine-2,4-dione (PubChem CID 125174710) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-methyl-5-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 125174710 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-methyl-5-[(1S)-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]pyrimidine-2,4-dione |
| SMILES | CC(C)[C@H]1c2[nH]c3ccccc3c2CCN1C(=O)c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H22N4O3/c1-11(2)17-16-13(12-6-4-5-7-15(12)21-16)8-9-24(17)19(26)14-10-23(3)20(27)22-18(14)25/h4-7,10-11,17,21H,8-9H2,1-3H3,(H,22,25,27)/t17-/m0/s1 |
| InChIKey | GOWXZUHVEUFOTJ-KRWDZBQOSA-N |
| XLogP | 1.95 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|