C19H22N2 — CID 7076705
(2S,3R,8R)-10,21-diazapentacyclo[12.7.0.02,10.03,8.015,20]henicosa-1(14),5,15,17,19-pentaene (PubChem CID 7076705) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2S,3R,8R)-10,21-diazapentacyclo[12.7.0.02,10.03,8.015,20]henicosa-1(14),5,15,17,19-pentaene.
| Compound Name | (2S,3R,8R)-10,21-diazapentacyclo[12.7.0.02,10.03,8.015,20]henicosa-1(14),5,15,17,19-pentaene |
|---|---|
| PubChem CID | 7076705 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2S,3R,8R)-10,21-diazapentacyclo[12.7.0.02,10.03,8.015,20]henicosa-1(14),5,15,17,19-pentaene |
| SMILES | C1=CC[C@@H]2[C@@H](C1)CN1CCCc3c([nH]c4ccccc34)[C@H]21 |
| InChI | InChI=1S/C19H22N2/c1-2-7-14-13(6-1)12-21-11-5-9-16-15-8-3-4-10-17(15)20-18(16)19(14)21/h1-4,8,10,13-14,19-20H,5-7,9,11-12H2/t13-,14+,19-/m0/s1 |
| InChIKey | XGOIUNFXMAIFSF-KSMMKXTCSA-N |
| XLogP | 4.05 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|