C17H12ClN3O — CID 135505767
5-chloro-9-oxido-10,20-diaza-9-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene (PubChem CID 135505767) has the molecular formula C17H12ClN3O and a molecular weight of 309.76 g/mol. Its IUPAC name is 5-chloro-9-oxido-10,20-diaza-9-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene.
| Compound Name | 5-chloro-9-oxido-10,20-diaza-9-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene |
|---|---|
| PubChem CID | 135505767 |
| Molecular Formula | C17H12ClN3O |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-chloro-9-oxido-10,20-diaza-9-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2,4,6,8,14,16,18-octaene |
| SMILES | [O-][n+]1c2ccc(Cl)cc2c2n1CCc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C17H12ClN3O/c18-10-5-6-15-13(9-10)17-16-12(7-8-20(17)21(15)22)11-3-1-2-4-14(11)19-16/h1-6,9,19H,7-8H2 |
| InChIKey | XHAYYWINRNCKBF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|