C19H15ClN3O+ — CID 123549263
7-chloro-21-methyl-3,13-diaza-21-azoniapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one (PubChem CID 123549263) has the molecular formula C19H15ClN3O+ and a molecular weight of 336.80 g/mol. Its IUPAC name is 7-chloro-21-methyl-3,13-diaza-21-azoniapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one.
| Compound Name | 7-chloro-21-methyl-3,13-diaza-21-azoniapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 123549263 |
| Molecular Formula | C19H15ClN3O+ |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 7-chloro-21-methyl-3,13-diaza-21-azoniapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
| SMILES | C[n+]1c2n(c(=O)c3ccccc31)CCc1c-2[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H14ClN3O/c1-22-16-5-3-2-4-13(16)19(24)23-9-8-12-14-10-11(20)6-7-15(14)21-17(12)18(22)23/h2-7,10H,8-9H2,1H3/p+1 |
| InChIKey | QLJSODFVOPXFRC-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|