C15H12ClNO4 — CID 11858464
methyl 2-(6-chloro-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl)-2-oxoacetate (PubChem CID 11858464) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is methyl 2-(6-chloro-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl)-2-oxoacetate.
| Compound Name | methyl 2-(6-chloro-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 11858464 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | methyl 2-(6-chloro-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1CCc2c([nH]c3ccc(Cl)cc23)C1=O |
| InChI | InChI=1S/C15H12ClNO4/c1-21-15(20)14(19)9-4-3-8-10-6-7(16)2-5-11(10)17-12(8)13(9)18/h2,5-6,9,17H,3-4H2,1H3 |
| InChIKey | OULPJDRFBOPLTN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|