C16H18ClN3O — CID 3459836
6-chloro-N-(dimethylaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (PubChem CID 3459836) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 6-chloro-N-(dimethylaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide.
| Compound Name | 6-chloro-N-(dimethylaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 3459836 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 6-chloro-N-(dimethylaminomethylidene)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| SMILES | CN(C)/C=N/C(=O)C1CCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C16H18ClN3O/c1-20(2)9-18-16(21)12-5-3-4-11-13-8-10(17)6-7-14(13)19-15(11)12/h6-9,12,19H,3-5H2,1-2H3/b18-9+ |
| InChIKey | YDHGRKHSYRGHPQ-GIJQJNRQSA-N |
| XLogP | 3.36 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|