C16H12ClIN2 — CID 53325746
7-chloro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium iodide (PubChem CID 53325746) has the molecular formula C16H12ClIN2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 7-chloro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium iodide.
| Compound Name | 7-chloro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium iodide |
|---|---|
| PubChem CID | 53325746 |
| Molecular Formula | C16H12ClIN2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 7-chloro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium iodide |
| SMILES | C[n+]1c2ccccc2cc2[nH]c3ccc(Cl)cc3c21.[I-] |
| InChI | InChI=1S/C16H11ClN2.HI/c1-19-15-5-3-2-4-10(15)8-14-16(19)12-9-11(17)6-7-13(12)18-14;/h2-9H,1H3;1H |
| InChIKey | ZDKAWLUYIMHOFM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|