C16H11ClN4O4 — CID 45266499
5-methyl-6,8-dinitro-10H-indolo[3,2-b]quinolin-5-ium chloride (PubChem CID 45266499) has the molecular formula C16H11ClN4O4 and a molecular weight of 358.74 g/mol. Its IUPAC name is 5-methyl-6,8-dinitro-10H-indolo[3,2-b]quinolin-5-ium chloride.
| Compound Name | 5-methyl-6,8-dinitro-10H-indolo[3,2-b]quinolin-5-ium chloride |
|---|---|
| PubChem CID | 45266499 |
| Molecular Formula | C16H11ClN4O4 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-methyl-6,8-dinitro-10H-indolo[3,2-b]quinolin-5-ium chloride |
| SMILES | C[n+]1c2ccccc2cc2[nH]c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3c21.[Cl-] |
| InChI | InChI=1S/C16H10N4O4.ClH/c1-18-13-5-3-2-4-9(13)6-12-16(18)15-11(17-12)7-10(19(21)22)8-14(15)20(23)24;/h2-8H,1H3;1H |
| InChIKey | ANBVSIBXJYCNGQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|