C16H13N3O6S — CID 10317326
hydrogen sulfate;5-methyl-3-nitro-10H-indolo[3,2-b]quinolin-5-ium (PubChem CID 10317326) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is hydrogen sulfate;5-methyl-3-nitro-10H-indolo[3,2-b]quinolin-5-ium.
| Compound Name | hydrogen sulfate;5-methyl-3-nitro-10H-indolo[3,2-b]quinolin-5-ium |
|---|---|
| PubChem CID | 10317326 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | hydrogen sulfate;5-methyl-3-nitro-10H-indolo[3,2-b]quinolin-5-ium |
| SMILES | C[n+]1c2cc([N+](=O)[O-])ccc2cc2[nH]c3ccccc3c21.O=S(=O)([O-])O |
| InChI | InChI=1S/C16H11N3O2.H2O4S/c1-18-15-9-11(19(20)21)7-6-10(15)8-14-16(18)12-4-2-3-5-13(12)17-14;1-5(2,3)4/h2-9H,1H3;(H2,1,2,3,4) |
| InChIKey | DWJUVPARLOBNQQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|