C20H12ClN3O4 — CID 15496529
9-(4-nitrophenyl)-5-oxa-17-aza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaen-4-one chloride (PubChem CID 15496529) has the molecular formula C20H12ClN3O4 and a molecular weight of 393.79 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-5-oxa-17-aza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaen-4-one chloride.
| Compound Name | 9-(4-nitrophenyl)-5-oxa-17-aza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaen-4-one chloride |
|---|---|
| PubChem CID | 15496529 |
| Molecular Formula | C20H12ClN3O4 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 9-(4-nitrophenyl)-5-oxa-17-aza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,8,11,13,15-heptaen-4-one chloride |
| SMILES | O=c1occc2c1cc1[nH]c3ccccc3c1[n+]2-c1ccc([N+](=O)[O-])cc1.[Cl-] |
| InChI | InChI=1S/C20H11N3O4.ClH/c24-20-15-11-17-19(14-3-1-2-4-16(14)21-17)22(18(15)9-10-27-20)12-5-7-13(8-6-12)23(25)26;/h1-11H;1H |
| InChIKey | LLVZEVVASBCDAI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|